C34H36N2O4 — CID 123933395
2-[3,5-dimethyl-6-(1-methyliminobut-2-en-2-yl)-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid (PubChem CID 123933395) has the molecular formula C34H36N2O4 and a molecular weight of 536.67 g/mol. Its IUPAC name is 2-[3,5-dimethyl-6-(1-methyliminobut-2-en-2-yl)-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid.
| Compound Name | 2-[3,5-dimethyl-6-(1-methyliminobut-2-en-2-yl)-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
|---|---|
| PubChem CID | 123933395 |
| Molecular Formula | C34H36N2O4 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 2-[3,5-dimethyl-6-(1-methyliminobut-2-en-2-yl)-1-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)naphthalen-2-yl]-2-[(2-methylpropan-2-yl)oxy]acetic acid |
| SMILES | CC=C(/C=N/C)c1ccc2c(-c3ccc4c5c(ccnc35)CCO4)c(C(OC(C)(C)C)C(=O)O)c(C)cc2c1C |
| InChI | InChI=1S/C34H36N2O4/c1-8-21(18-35-7)23-9-10-24-26(20(23)3)17-19(2)28(32(33(37)38)40-34(4,5)6)30(24)25-11-12-27-29-22(14-16-39-27)13-15-36-31(25)29/h8-13,15,17-18,32H,14,16H2,1-7H3,(H,37,38)/b21-8?,35-18+ |
| InChIKey | KHLQBDJTOHLHKM-LLILBQEISA-N |
| XLogP | 7.65 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|