About 3-iminohex-4-en-2-yl acetate
3-iminohex-4-en-2-yl acetate (PubChem CID 123933445) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-iminohex-4-en-2-yl acetate.
Molecular Properties
| Compound Name | 3-iminohex-4-en-2-yl acetate |
| PubChem CID | 123933445 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 3-iminohex-4-en-2-yl acetate |
| SMILES | [H]/N=C(\C=CC)C(C)OC(C)=O |
| InChI | InChI=1S/C8H13NO2/c1-4-5-8(9)6(2)11-7(3)10/h4-6,9H,1-3H3/b5-4?,9-8+ |
| InChIKey | KVNNEORQWNNTAB-JJTCNKLTSA-N |
| XLogP | 1.53 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminohex-4-en-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminohex-4-en-2-yl acetate?
The IUPAC name of 3-iminohex-4-en-2-yl acetate (CID 123933445) is 3-iminohex-4-en-2-yl acetate.
What is the SMILES notation for 3-iminohex-4-en-2-yl acetate?
The canonical SMILES for 3-iminohex-4-en-2-yl acetate is [H]/N=C(\C=CC)C(C)OC(C)=O.
What is the InChIKey of 3-iminohex-4-en-2-yl acetate?
The InChIKey is KVNNEORQWNNTAB-JJTCNKLTSA-N. The full InChI is InChI=1S/C8H13NO2/c1-4-5-8(9)6(2)11-7(3)10/h4-6,9H,1-3H3/b5-4?,9-8+.
What are the key properties of 3-iminohex-4-en-2-yl acetate?
3-iminohex-4-en-2-yl acetate has a molecular weight of 155.20 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminohex-4-en-2-yl acetate is sourced from PubChem (CID 123933445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).