C39H58O2 — CID 123933653
2-(2,6,7,7-tetramethylnonan-2-yl)-7-(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione (PubChem CID 123933653) has the molecular formula C39H58O2 and a molecular weight of 558.89 g/mol. Its IUPAC name is 2-(2,6,7,7-tetramethylnonan-2-yl)-7-(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione.
| Compound Name | 2-(2,6,7,7-tetramethylnonan-2-yl)-7-(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 123933653 |
| Molecular Formula | C39H58O2 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.44 |
| IUPAC Name | 2-(2,6,7,7-tetramethylnonan-2-yl)-7-(2,6,7,7-tetramethyloctan-2-yl)anthracene-9,10-dione |
| SMILES | CCC(C)(C)C(C)CCCC(C)(C)c1ccc2c(c1)C(=O)c1cc(C(C)(C)CCCC(C)C(C)(C)C)ccc1C2=O |
| InChI | InChI=1S/C39H58O2/c1-13-37(7,8)27(3)17-15-23-39(11,12)29-19-21-31-33(25-29)35(41)32-24-28(18-20-30(32)34(31)40)38(9,10)22-14-16-26(2)36(4,5)6/h18-21,24-27H,13-17,22-23H2,1-12H3 |
| InChIKey | VVGIPWNKUAXWEE-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|