About 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium
4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium (PubChem CID 123934866) has the molecular formula C9H14NO+
and a molecular weight of 152.22 g/mol. Its IUPAC name is 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium.
Molecular Properties
| Compound Name | 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium |
| PubChem CID | 123934866 |
| Molecular Formula | C9H14NO+ |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium |
| SMILES | C=CC(=CC(=C)[N+](=C)C)OC |
| InChI | InChI=1S/C9H14NO/c1-6-9(11-5)7-8(2)10(3)4/h6-7H,1-3H2,4-5H3/q+1 |
| InChIKey | XNHIVGTYVZLURO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium?
The IUPAC name of 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium (CID 123934866) is 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium.
What is the SMILES notation for 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium?
The canonical SMILES for 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium is C=CC(=CC(=C)[N+](=C)C)OC.
What is the InChIKey of 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium?
The InChIKey is XNHIVGTYVZLURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14NO/c1-6-9(11-5)7-8(2)10(3)4/h6-7H,1-3H2,4-5H3/q+1.
What are the key properties of 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium?
4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium has a molecular weight of 152.22 g/mol, XLogP of 1.56, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxyhexa-1,3,5-trien-2-yl-methyl-methylideneazanium is sourced from PubChem (CID 123934866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).