C27H27ClFN5O — CID 123935340
5-chloro-10-ethyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.012,16]hexadeca-2,5,9-trien-7-one (PubChem CID 123935340) has the molecular formula C27H27ClFN5O and a molecular weight of 492.00 g/mol. Its IUPAC name is 5-chloro-10-ethyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.012,16]hexadeca-2,5,9-trien-7-one.
| Compound Name | 5-chloro-10-ethyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.012,16]hexadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 123935340 |
| Molecular Formula | C27H27ClFN5O |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-chloro-10-ethyl-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-1,3,4,8-tetrazatetracyclo[7.7.0.02,6.012,16]hexadeca-2,5,9-trien-7-one |
| SMILES | CCC1=C2N(C)C(=O)c3c(nn(Cc4ccc(-c5cccc(F)n5)cc4)c3Cl)N2C2CCCC2C1 |
| InChI | InChI=1S/C27H27ClFN5O/c1-3-17-14-19-6-4-8-21(19)34-25-23(27(35)32(2)26(17)34)24(28)33(31-25)15-16-10-12-18(13-11-16)20-7-5-9-22(29)30-20/h5,7,9-13,19,21H,3-4,6,8,14-15H2,1-2H3 |
| InChIKey | DCSVBHKAWVILPP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|