About (4Z)-2-fluorohexa-1,4-dien-3-imine
(4Z)-2-fluorohexa-1,4-dien-3-imine (PubChem CID 123935448) has the molecular formula C6H8FN
and a molecular weight of 113.13 g/mol. Its IUPAC name is (4Z)-2-fluorohexa-1,4-dien-3-imine.
Molecular Properties
| Compound Name | (4Z)-2-fluorohexa-1,4-dien-3-imine |
| PubChem CID | 123935448 |
| Molecular Formula | C6H8FN |
| Molecular Weight | 113.13 g/mol |
| Exact Mass | 113.06 |
| IUPAC Name | (4Z)-2-fluorohexa-1,4-dien-3-imine |
| SMILES | [H]/N=C(/C=C\C)C(=C)F |
| InChI | InChI=1S/C6H8FN/c1-3-4-6(8)5(2)7/h3-4,8H,2H2,1H3/b4-3-,8-6- |
| InChIKey | RINCZZRPCHPLEZ-XYMCEGRYSA-N |
| XLogP | 2.07 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.13 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-fluorohexa-1,4-dien-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-fluorohexa-1,4-dien-3-imine?
The IUPAC name of (4Z)-2-fluorohexa-1,4-dien-3-imine (CID 123935448) is (4Z)-2-fluorohexa-1,4-dien-3-imine.
What is the SMILES notation for (4Z)-2-fluorohexa-1,4-dien-3-imine?
The canonical SMILES for (4Z)-2-fluorohexa-1,4-dien-3-imine is [H]/N=C(/C=C\C)C(=C)F.
What is the InChIKey of (4Z)-2-fluorohexa-1,4-dien-3-imine?
The InChIKey is RINCZZRPCHPLEZ-XYMCEGRYSA-N. The full InChI is InChI=1S/C6H8FN/c1-3-4-6(8)5(2)7/h3-4,8H,2H2,1H3/b4-3-,8-6-.
What are the key properties of (4Z)-2-fluorohexa-1,4-dien-3-imine?
(4Z)-2-fluorohexa-1,4-dien-3-imine has a molecular weight of 113.13 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-fluorohexa-1,4-dien-3-imine is sourced from PubChem (CID 123935448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).