About (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone
(2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone (PubChem CID 123935616) has the molecular formula C10H10FN3O
and a molecular weight of 207.21 g/mol. Its IUPAC name is (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone.
Molecular Properties
| Compound Name | (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone |
| PubChem CID | 123935616 |
| Molecular Formula | C10H10FN3O |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone |
| SMILES | Cn1cncc1C(=O)C1=CN=C(F)CC1 |
| InChI | InChI=1S/C10H10FN3O/c1-14-6-12-5-8(14)10(15)7-2-3-9(11)13-4-7/h4-6H,2-3H2,1H3 |
| InChIKey | MUGZIAUZSBLQMS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone?
The IUPAC name of (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone (CID 123935616) is (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone.
What is the SMILES notation for (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone?
The canonical SMILES for (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone is Cn1cncc1C(=O)C1=CN=C(F)CC1.
What is the InChIKey of (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone?
The InChIKey is MUGZIAUZSBLQMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN3O/c1-14-6-12-5-8(14)10(15)7-2-3-9(11)13-4-7/h4-6H,2-3H2,1H3.
What are the key properties of (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone?
(2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone has a molecular weight of 207.21 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-fluoro-3,4-dihydropyridin-5-yl)-(3-methylimidazol-4-yl)methanone is sourced from PubChem (CID 123935616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).