C21H23NO4 — CID 123936723
2-[[(1R,2S,6R,7S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-1-yl]methoxy]acetonitrile (PubChem CID 123936723) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-[[(1R,2S,6R,7S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-1-yl]methoxy]acetonitrile.
| Compound Name | 2-[[(1R,2S,6R,7S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-1-yl]methoxy]acetonitrile |
|---|---|
| PubChem CID | 123936723 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 2-[[(1R,2S,6R,7S)-3,5-dioxo-4-(2,4,6-trimethylphenyl)-10-oxatricyclo[5.2.1.02,6]decan-1-yl]methoxy]acetonitrile |
| SMILES | Cc1cc(C)c(C2C(=O)[C@H]3[C@@H]4CC[C@@](COCC#N)(O4)[C@H]3C2=O)c(C)c1 |
| InChI | InChI=1S/C21H23NO4/c1-11-8-12(2)15(13(3)9-11)17-19(23)16-14-4-5-21(26-14,10-25-7-6-22)18(16)20(17)24/h8-9,14,16-18H,4-5,7,10H2,1-3H3/t14-,16-,17?,18+,21-/m0/s1 |
| InChIKey | KSTOWPVYZZERRW-OHURZGMXSA-N |
| XLogP | 2.55 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|