C24H43NO6S — CID 123936939
9-ethyl-4-imino-2,7,7,9-tetramethyl-11-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]sulfanyl]undecan-3-one (PubChem CID 123936939) has the molecular formula C24H43NO6S and a molecular weight of 473.68 g/mol. Its IUPAC name is 9-ethyl-4-imino-2,7,7,9-tetramethyl-11-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]sulfanyl]undecan-3-one.
| Compound Name | 9-ethyl-4-imino-2,7,7,9-tetramethyl-11-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]sulfanyl]undecan-3-one |
|---|---|
| PubChem CID | 123936939 |
| Molecular Formula | C24H43NO6S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 9-ethyl-4-imino-2,7,7,9-tetramethyl-11-[[2,3,5-trihydroxy-4-(hydroxymethyl)-6-oxabicyclo[3.2.0]heptan-7-yl]sulfanyl]undecan-3-one |
| SMILES | [H]/N=C(/CCC(C)(C)CC(C)(CC)CCSC1OC2(O)C(CO)C(O)C(O)C12)C(=O)C(C)C |
| InChI | InChI=1S/C24H43NO6S/c1-7-23(6,13-22(4,5)9-8-16(25)18(27)14(2)3)10-11-32-21-17-20(29)19(28)15(12-26)24(17,30)31-21/h14-15,17,19-21,25-26,28-30H,7-13H2,1-6H3/b25-16- |
| InChIKey | KPETZNKDUVEWNY-XYGWBWBKSA-N |
| XLogP | 2.97 |
| TPSA | 131.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|