About 1-pyridazin-3-yl-1,3,5-triazin-1-ium
1-pyridazin-3-yl-1,3,5-triazin-1-ium (PubChem CID 123936998) has the molecular formula C7H6N5+
and a molecular weight of 160.16 g/mol. Its IUPAC name is 1-pyridazin-3-yl-1,3,5-triazin-1-ium.
Molecular Properties
| Compound Name | 1-pyridazin-3-yl-1,3,5-triazin-1-ium |
| PubChem CID | 123936998 |
| Molecular Formula | C7H6N5+ |
| Molecular Weight | 160.16 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | 1-pyridazin-3-yl-1,3,5-triazin-1-ium |
| SMILES | c1cnnc(-[n+]2cncnc2)c1 |
| InChI | InChI=1S/C7H6N5/c1-2-7(11-10-3-1)12-5-8-4-9-6-12/h1-6H/q+1 |
| InChIKey | WCVMBNIYAFBSOX-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 55.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridazin-3-yl-1,3,5-triazin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridazin-3-yl-1,3,5-triazin-1-ium?
The IUPAC name of 1-pyridazin-3-yl-1,3,5-triazin-1-ium (CID 123936998) is 1-pyridazin-3-yl-1,3,5-triazin-1-ium.
What is the SMILES notation for 1-pyridazin-3-yl-1,3,5-triazin-1-ium?
The canonical SMILES for 1-pyridazin-3-yl-1,3,5-triazin-1-ium is c1cnnc(-[n+]2cncnc2)c1.
What is the InChIKey of 1-pyridazin-3-yl-1,3,5-triazin-1-ium?
The InChIKey is WCVMBNIYAFBSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N5/c1-2-7(11-10-3-1)12-5-8-4-9-6-12/h1-6H/q+1.
What are the key properties of 1-pyridazin-3-yl-1,3,5-triazin-1-ium?
1-pyridazin-3-yl-1,3,5-triazin-1-ium has a molecular weight of 160.16 g/mol, XLogP of -0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridazin-3-yl-1,3,5-triazin-1-ium is sourced from PubChem (CID 123936998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).