C25H27FN6O2 — CID 123937099
4-(dimethylamino)-1-[3-[[6-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one (PubChem CID 123937099) has the molecular formula C25H27FN6O2 and a molecular weight of 462.53 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[3-[[6-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one.
| Compound Name | 4-(dimethylamino)-1-[3-[[6-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 123937099 |
| Molecular Formula | C25H27FN6O2 |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | 4-(dimethylamino)-1-[3-[[6-[3-(2-fluorophenoxy)prop-1-ynyl]-7H-pyrrolo[2,3-d]pyrimidin-4-yl]amino]pyrrolidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)N1CCC(Nc2ncnc3[nH]c(C#CCOc4ccccc4F)cc23)C1 |
| InChI | InChI=1S/C25H27FN6O2/c1-31(2)12-5-10-23(33)32-13-11-19(16-32)30-25-20-15-18(29-24(20)27-17-28-25)7-6-14-34-22-9-4-3-8-21(22)26/h3-5,8-10,15,17,19H,11-14,16H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | QTZHDPZDLHXYIT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|