C18H22N6O — CID 123937106
3-[[8-(4-ethylphenyl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]cyclopentane-1-carboxamide (PubChem CID 123937106) has the molecular formula C18H22N6O and a molecular weight of 338.42 g/mol. Its IUPAC name is 3-[[8-(4-ethylphenyl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]cyclopentane-1-carboxamide.
| Compound Name | 3-[[8-(4-ethylphenyl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 123937106 |
| Molecular Formula | C18H22N6O |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 3-[[8-(4-ethylphenyl)-2,4,7,8-tetrazabicyclo[4.2.0]octa-1,3,5-trien-3-yl]amino]cyclopentane-1-carboxamide |
| SMILES | CCc1ccc(-n2[nH]c3cnc(NC4CCC(C(N)=O)C4)nc32)cc1 |
| InChI | InChI=1S/C18H22N6O/c1-2-11-3-7-14(8-4-11)24-17-15(23-24)10-20-18(22-17)21-13-6-5-12(9-13)16(19)25/h3-4,7-8,10,12-13,23H,2,5-6,9H2,1H3,(H2,19,25)(H,20,21,22) |
| InChIKey | FREBSUYRAOESMD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |