About 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid
2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid (PubChem CID 123937768) has the molecular formula C12H18N6O2S
and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid |
| PubChem CID | 123937768 |
| Molecular Formula | C12H18N6O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)O)C(Cc1cnc(N)s1)c1nn[nH]n1 |
| InChI | InChI=1S/C12H18N6O2S/c1-6(2)3-9(11(19)20)8(10-15-17-18-16-10)4-7-5-14-12(13)21-7/h5-6,8-9H,3-4H2,1-2H3,(H2,13,14)(H,19,20)(H,15,16,17,18) |
| InChIKey | JZOQNUXWTHZAIR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid?
The IUPAC name of 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid (CID 123937768) is 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid.
What is the SMILES notation for 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid?
The canonical SMILES for 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid is CC(C)CC(C(=O)O)C(Cc1cnc(N)s1)c1nn[nH]n1.
What is the InChIKey of 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid?
The InChIKey is JZOQNUXWTHZAIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N6O2S/c1-6(2)3-9(11(19)20)8(10-15-17-18-16-10)4-7-5-14-12(13)21-7/h5-6,8-9H,3-4H2,1-2H3,(H2,13,14)(H,19,20)(H,15,16,17,18).
What are the key properties of 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid?
2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid has a molecular weight of 310.38 g/mol, XLogP of 1.31, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-amino-1,3-thiazol-5-yl)-1-(2H-tetrazol-5-yl)ethyl]-4-methylpentanoic acid is sourced from PubChem (CID 123937768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).