About (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate
(2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate (PubChem CID 123938405) has the molecular formula C11H13F2NO4
and a molecular weight of 261.22 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate |
| PubChem CID | 123938405 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate |
| SMILES | O=C(On1c(O)ccc1O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H13F2NO4/c12-11(13)5-3-7(4-6-11)10(17)18-14-8(15)1-2-9(14)16/h1-2,7,15-16H,3-6H2 |
| InChIKey | PLFYFEDBHWMRQD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate?
The IUPAC name of (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate (CID 123938405) is (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate.
What is the SMILES notation for (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate?
The canonical SMILES for (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate is O=C(On1c(O)ccc1O)C1CCC(F)(F)CC1.
What is the InChIKey of (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate?
The InChIKey is PLFYFEDBHWMRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO4/c12-11(13)5-3-7(4-6-11)10(17)18-14-8(15)1-2-9(14)16/h1-2,7,15-16H,3-6H2.
What are the key properties of (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate?
(2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate has a molecular weight of 261.22 g/mol, XLogP of 1.68, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dihydroxypyrrol-1-yl) 4,4-difluorocyclohexane-1-carboxylate is sourced from PubChem (CID 123938405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).