C11H16 — CID 123939025
3,4-dimethylhexa-1,4,5-trien-2-ylcyclopropane (PubChem CID 123939025) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 3,4-dimethylhexa-1,4,5-trien-2-ylcyclopropane.
| Compound Name | 3,4-dimethylhexa-1,4,5-trien-2-ylcyclopropane |
|---|---|
| PubChem CID | 123939025 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 3,4-dimethylhexa-1,4,5-trien-2-ylcyclopropane |
| SMILES | C=C=C(C)C(C)C(=C)C1CC1 |
| InChI | InChI=1S/C11H16/c1-5-8(2)9(3)10(4)11-6-7-11/h9,11H,1,4,6-7H2,2-3H3 |
| InChIKey | ZFABHHGXNVWKBU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|