C8H12N2 — CID 123939730
3-methyl-5,6,7,7a-tetrahydro-3H-indazole (PubChem CID 123939730) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 3-methyl-5,6,7,7a-tetrahydro-3H-indazole.
| Compound Name | 3-methyl-5,6,7,7a-tetrahydro-3H-indazole |
|---|---|
| PubChem CID | 123939730 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3-methyl-5,6,7,7a-tetrahydro-3H-indazole |
| SMILES | CC1N=NC2CCCC=C12 |
| InChI | InChI=1S/C8H12N2/c1-6-7-4-2-3-5-8(7)10-9-6/h4,6,8H,2-3,5H2,1H3 |
| InChIKey | YCMUKZKOBLYBAH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|