About (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate
(2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate (PubChem CID 123939783) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate.
Molecular Properties
| Compound Name | (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate |
| PubChem CID | 123939783 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate |
| SMILES | CC(=O)OCC(=C1C=CC=CC1)S(C)(=O)=O |
| InChI | InChI=1S/C11H14O4S/c1-9(12)15-8-11(16(2,13)14)10-6-4-3-5-7-10/h3-6H,7-8H2,1-2H3 |
| InChIKey | PJZLQLMQHCLTTO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate?
The IUPAC name of (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate (CID 123939783) is (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate.
What is the SMILES notation for (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate?
The canonical SMILES for (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate is CC(=O)OCC(=C1C=CC=CC1)S(C)(=O)=O.
What is the InChIKey of (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate?
The InChIKey is PJZLQLMQHCLTTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c1-9(12)15-8-11(16(2,13)14)10-6-4-3-5-7-10/h3-6H,7-8H2,1-2H3.
What are the key properties of (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate?
(2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate has a molecular weight of 242.30 g/mol, XLogP of 1.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-cyclohexa-2,4-dien-1-ylidene-2-methylsulfonylethyl) acetate is sourced from PubChem (CID 123939783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).