C23H25N5O4S — CID 123939848
2-[[5-[5-[3-[[4-(methyliminomethylamino)phenyl]methoxy]phenyl]oxolan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid (PubChem CID 123939848) has the molecular formula C23H25N5O4S and a molecular weight of 467.55 g/mol. Its IUPAC name is 2-[[5-[5-[3-[[4-(methyliminomethylamino)phenyl]methoxy]phenyl]oxolan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[5-[5-[3-[[4-(methyliminomethylamino)phenyl]methoxy]phenyl]oxolan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 123939848 |
| Molecular Formula | C23H25N5O4S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[[5-[5-[3-[[4-(methyliminomethylamino)phenyl]methoxy]phenyl]oxolan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetic acid |
| SMILES | C/N=C/Nc1ccc(COc2cccc(C3CCC(c4nc(SCC(=O)O)n[nH]4)O3)c2)cc1 |
| InChI | InChI=1S/C23H25N5O4S/c1-24-14-25-17-7-5-15(6-8-17)12-31-18-4-2-3-16(11-18)19-9-10-20(32-19)22-26-23(28-27-22)33-13-21(29)30/h2-8,11,14,19-20H,9-10,12-13H2,1H3,(H,24,25)(H,29,30)(H,26,27,28) |
| InChIKey | BPBQQLHIZIQPIL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|