C9H14FNO — CID 123939948
(6-fluoro-2,3,3a,6,7,7a-hexahydro-1H-indol-3-yl)methanol (PubChem CID 123939948) has the molecular formula C9H14FNO and a molecular weight of 171.22 g/mol. Its IUPAC name is (6-fluoro-2,3,3a,6,7,7a-hexahydro-1H-indol-3-yl)methanol.
| Compound Name | (6-fluoro-2,3,3a,6,7,7a-hexahydro-1H-indol-3-yl)methanol |
|---|---|
| PubChem CID | 123939948 |
| Molecular Formula | C9H14FNO |
| Molecular Weight | 171.22 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (6-fluoro-2,3,3a,6,7,7a-hexahydro-1H-indol-3-yl)methanol |
| SMILES | OCC1CNC2CC(F)C=CC12 |
| InChI | InChI=1S/C9H14FNO/c10-7-1-2-8-6(5-12)4-11-9(8)3-7/h1-2,6-9,11-12H,3-5H2 |
| InChIKey | BBWQXKLWBDAKEH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.22 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|