About 2,3-dimethyl-3,4-dihydrodiazepine
2,3-dimethyl-3,4-dihydrodiazepine (PubChem CID 123940020) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 2,3-dimethyl-3,4-dihydrodiazepine.
Molecular Properties
| Compound Name | 2,3-dimethyl-3,4-dihydrodiazepine |
| PubChem CID | 123940020 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 2,3-dimethyl-3,4-dihydrodiazepine |
| SMILES | CC1CC=CC=NN1C |
| InChI | InChI=1S/C7H12N2/c1-7-5-3-4-6-8-9(7)2/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | LLTGSZWZZXROMJ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dimethyl-3,4-dihydrodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-3,4-dihydrodiazepine?
The IUPAC name of 2,3-dimethyl-3,4-dihydrodiazepine (CID 123940020) is 2,3-dimethyl-3,4-dihydrodiazepine.
What is the SMILES notation for 2,3-dimethyl-3,4-dihydrodiazepine?
The canonical SMILES for 2,3-dimethyl-3,4-dihydrodiazepine is CC1CC=CC=NN1C.
What is the InChIKey of 2,3-dimethyl-3,4-dihydrodiazepine?
The InChIKey is LLTGSZWZZXROMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-7-5-3-4-6-8-9(7)2/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 2,3-dimethyl-3,4-dihydrodiazepine?
2,3-dimethyl-3,4-dihydrodiazepine has a molecular weight of 124.19 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-3,4-dihydrodiazepine is sourced from PubChem (CID 123940020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).