About 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate
2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate (PubChem CID 123940096) has the molecular formula C15H23N3O4
and a molecular weight of 309.37 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate |
| PubChem CID | 123940096 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate |
| SMILES | C=CC(=O)NC(C=C(C)C(=O)OCCN(C)C)NC(=O)C=C |
| InChI | InChI=1S/C15H23N3O4/c1-6-13(19)16-12(17-14(20)7-2)10-11(3)15(21)22-9-8-18(4)5/h6-7,10,12H,1-2,8-9H2,3-5H3,(H,16,19)(H,17,20) |
| InChIKey | SZYCCHNHHXURSC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate?
The IUPAC name of 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate (CID 123940096) is 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate.
What is the SMILES notation for 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate?
The canonical SMILES for 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate is C=CC(=O)NC(C=C(C)C(=O)OCCN(C)C)NC(=O)C=C.
What is the InChIKey of 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate?
The InChIKey is SZYCCHNHHXURSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4/c1-6-13(19)16-12(17-14(20)7-2)10-11(3)15(21)22-9-8-18(4)5/h6-7,10,12H,1-2,8-9H2,3-5H3,(H,16,19)(H,17,20).
What are the key properties of 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate?
2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate has a molecular weight of 309.37 g/mol, XLogP of -0.03, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl 2-methyl-4,4-bis(prop-2-enoylamino)but-2-enoate is sourced from PubChem (CID 123940096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).