About 8-propanoyl-2,3-dihydro-1H-indolizin-5-one
8-propanoyl-2,3-dihydro-1H-indolizin-5-one (PubChem CID 123940299) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-propanoyl-2,3-dihydro-1H-indolizin-5-one.
Molecular Properties
| Compound Name | 8-propanoyl-2,3-dihydro-1H-indolizin-5-one |
| PubChem CID | 123940299 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 8-propanoyl-2,3-dihydro-1H-indolizin-5-one |
| SMILES | CCC(=O)c1ccc(=O)n2c1CCC2 |
| InChI | InChI=1S/C11H13NO2/c1-2-10(13)8-5-6-11(14)12-7-3-4-9(8)12/h5-6H,2-4,7H2,1H3 |
| InChIKey | IHFMPUADJMVTAK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-propanoyl-2,3-dihydro-1H-indolizin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propanoyl-2,3-dihydro-1H-indolizin-5-one?
The IUPAC name of 8-propanoyl-2,3-dihydro-1H-indolizin-5-one (CID 123940299) is 8-propanoyl-2,3-dihydro-1H-indolizin-5-one.
What is the SMILES notation for 8-propanoyl-2,3-dihydro-1H-indolizin-5-one?
The canonical SMILES for 8-propanoyl-2,3-dihydro-1H-indolizin-5-one is CCC(=O)c1ccc(=O)n2c1CCC2.
What is the InChIKey of 8-propanoyl-2,3-dihydro-1H-indolizin-5-one?
The InChIKey is IHFMPUADJMVTAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-10(13)8-5-6-11(14)12-7-3-4-9(8)12/h5-6H,2-4,7H2,1H3.
What are the key properties of 8-propanoyl-2,3-dihydro-1H-indolizin-5-one?
8-propanoyl-2,3-dihydro-1H-indolizin-5-one has a molecular weight of 191.23 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propanoyl-2,3-dihydro-1H-indolizin-5-one is sourced from PubChem (CID 123940299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).