C12H10F8N4 — CID 123940528
5-(4-ethylimidazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole (PubChem CID 123940528) has the molecular formula C12H10F8N4 and a molecular weight of 362.22 g/mol. Its IUPAC name is 5-(4-ethylimidazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole.
| Compound Name | 5-(4-ethylimidazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 123940528 |
| Molecular Formula | C12H10F8N4 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 5-(4-ethylimidazol-1-yl)-1-methyl-3-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)pyrazole |
| SMILES | CCc1cn(-c2c(C(F)(F)F)c(C(F)(F)C(F)(F)F)nn2C)cn1 |
| InChI | InChI=1S/C12H10F8N4/c1-3-6-4-24(5-21-6)9-7(11(15,16)17)8(22-23(9)2)10(13,14)12(18,19)20/h4-5H,3H2,1-2H3 |
| InChIKey | LFRMAHXKGJHOPL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|