About N,2-dimethyl-N-propylpenta-2,4-dien-1-amine
N,2-dimethyl-N-propylpenta-2,4-dien-1-amine (PubChem CID 123940693) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is N,2-dimethyl-N-propylpenta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N,2-dimethyl-N-propylpenta-2,4-dien-1-amine |
| PubChem CID | 123940693 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | N,2-dimethyl-N-propylpenta-2,4-dien-1-amine |
| SMILES | C=CC=C(C)CN(C)CCC |
| InChI | InChI=1S/C10H19N/c1-5-7-10(3)9-11(4)8-6-2/h5,7H,1,6,8-9H2,2-4H3 |
| InChIKey | VYAUSABILXNBEY-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethyl-N-propylpenta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N-propylpenta-2,4-dien-1-amine?
The IUPAC name of N,2-dimethyl-N-propylpenta-2,4-dien-1-amine (CID 123940693) is N,2-dimethyl-N-propylpenta-2,4-dien-1-amine.
What is the SMILES notation for N,2-dimethyl-N-propylpenta-2,4-dien-1-amine?
The canonical SMILES for N,2-dimethyl-N-propylpenta-2,4-dien-1-amine is C=CC=C(C)CN(C)CCC.
What is the InChIKey of N,2-dimethyl-N-propylpenta-2,4-dien-1-amine?
The InChIKey is VYAUSABILXNBEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-5-7-10(3)9-11(4)8-6-2/h5,7H,1,6,8-9H2,2-4H3.
What are the key properties of N,2-dimethyl-N-propylpenta-2,4-dien-1-amine?
N,2-dimethyl-N-propylpenta-2,4-dien-1-amine has a molecular weight of 153.27 g/mol, XLogP of 2.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N-propylpenta-2,4-dien-1-amine is sourced from PubChem (CID 123940693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).