3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid

C11H19NO3 — CID 123941175

IUPAC3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid
SMILESCC=C(CC)C(=O)NCC(C)(C)C(=O)O
InChIInChI=1S/C11H19NO3/c1-5-8(6-2)9(13)12-7-11(3,4)10(14)15/h5H,6-7H2,1-4H3,(H,12,13)(H,14,15)
InChIKeyKVQOIHYSBVPLMC-UHFFFAOYSA-N
MW213.28 g/mol
LogP1.57
Rot. Bonds5

About 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid

3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid (PubChem CID 123941175) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid
PubChem CID123941175
Molecular FormulaC11H19NO3
Molecular Weight213.28 g/mol
Exact Mass213.14
IUPAC Name3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid
SMILESCC=C(CC)C(=O)NCC(C)(C)C(=O)O
InChIInChI=1S/C11H19NO3/c1-5-8(6-2)9(13)12-7-11(3,4)10(14)15/h5H,6-7H2,1-4H3,(H,12,13)(H,14,15)
InChIKeyKVQOIHYSBVPLMC-UHFFFAOYSA-N
XLogP1.57
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 51.57
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid?
The IUPAC name of 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid (CID 123941175) is 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid.
What is the SMILES notation for 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid?
The canonical SMILES for 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid is CC=C(CC)C(=O)NCC(C)(C)C(=O)O.
What is the InChIKey of 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid?
The InChIKey is KVQOIHYSBVPLMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-5-8(6-2)9(13)12-7-11(3,4)10(14)15/h5H,6-7H2,1-4H3,(H,12,13)(H,14,15).
What are the key properties of 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid?
3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid has a molecular weight of 213.28 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylbut-2-enoylamino)-2,2-dimethylpropanoic acid is sourced from PubChem (CID 123941175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).