About [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol
[1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol (PubChem CID 123941620) has the molecular formula C13H17ClN2O2S
and a molecular weight of 300.81 g/mol. Its IUPAC name is [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol |
| PubChem CID | 123941620 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol |
| SMILES | CS(N)(=O)=CCCn1c(CO)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H17ClN2O2S/c1-19(15,18)6-2-5-16-12(9-17)8-10-7-11(14)3-4-13(10)16/h3-4,6-8,17H,2,5,9H2,1H3,(H2,15,18) |
| InChIKey | XBJHYWMCUXZOLO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol?
The IUPAC name of [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol (CID 123941620) is [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol.
What is the SMILES notation for [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol?
The canonical SMILES for [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol is CS(N)(=O)=CCCn1c(CO)cc2cc(Cl)ccc21.
What is the InChIKey of [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol?
The InChIKey is XBJHYWMCUXZOLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2S/c1-19(15,18)6-2-5-16-12(9-17)8-10-7-11(14)3-4-13(10)16/h3-4,6-8,17H,2,5,9H2,1H3,(H2,15,18).
What are the key properties of [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol?
[1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol has a molecular weight of 300.81 g/mol, XLogP of 1.77, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol is sourced from PubChem (CID 123941620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).