C13H17ClN2O2S — CID 123941620
[1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol (PubChem CID 123941620) has the molecular formula C13H17ClN2O2S and a molecular weight of 300.81 g/mol. Its IUPAC name is [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol.
| Compound Name | [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol |
|---|---|
| PubChem CID | 123941620 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [1-[3-(amino-methyl-oxo-λ6-sulfanylidene)propyl]-5-chloroindol-2-yl]methanol |
| SMILES | CS(N)(=O)=CCCn1c(CO)cc2cc(Cl)ccc21 |
| InChI | InChI=1S/C13H17ClN2O2S/c1-19(15,18)6-2-5-16-12(9-17)8-10-7-11(14)3-4-13(10)16/h3-4,6-8,17H,2,5,9H2,1H3,(H2,15,18) |
| InChIKey | XBJHYWMCUXZOLO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|