C13H31NO2Si — CID 123941682
4-[butyl(dimethoxymethyl)silyl]-2,2-dimethylbutan-1-amine (PubChem CID 123941682) has the molecular formula C13H31NO2Si and a molecular weight of 261.48 g/mol. Its IUPAC name is 4-[butyl(dimethoxymethyl)silyl]-2,2-dimethylbutan-1-amine.
| Compound Name | 4-[butyl(dimethoxymethyl)silyl]-2,2-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 123941682 |
| Molecular Formula | C13H31NO2Si |
| Molecular Weight | 261.48 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 4-[butyl(dimethoxymethyl)silyl]-2,2-dimethylbutan-1-amine |
| SMILES | CCCC[SiH](CCC(C)(C)CN)C(OC)OC |
| InChI | InChI=1S/C13H31NO2Si/c1-6-7-9-17(12(15-4)16-5)10-8-13(2,3)11-14/h12,17H,6-11,14H2,1-5H3 |
| InChIKey | XPQSVTCJFQBOHG-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|