C22H40N2O3 — CID 123941695
2,2-dimethylpropyl 4-[2-[2-(piperidin-4-ylmethoxy)ethyl]cyclopropyl]piperidine-1-carboxylate (PubChem CID 123941695) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-[2-[2-(piperidin-4-ylmethoxy)ethyl]cyclopropyl]piperidine-1-carboxylate.
| Compound Name | 2,2-dimethylpropyl 4-[2-[2-(piperidin-4-ylmethoxy)ethyl]cyclopropyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 123941695 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | 2,2-dimethylpropyl 4-[2-[2-(piperidin-4-ylmethoxy)ethyl]cyclopropyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)COC(=O)N1CCC(C2CC2CCOCC2CCNCC2)CC1 |
| InChI | InChI=1S/C22H40N2O3/c1-22(2,3)16-27-21(25)24-11-6-18(7-12-24)20-14-19(20)8-13-26-15-17-4-9-23-10-5-17/h17-20,23H,4-16H2,1-3H3 |
| InChIKey | OKSFFAQCBPFSOP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|