C16H15F3N2O4 — CID 123942057
N-(3,4-dihydro-2H-chromen-4-yl)-4,5-dioxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 123942057) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-4-yl)-4,5-dioxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-4-yl)-4,5-dioxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 123942057 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-4-yl)-4,5-dioxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCOc2ccccc21)C1CN(CC(F)(F)F)C(=O)C1=O |
| InChI | InChI=1S/C16H15F3N2O4/c17-16(18,19)8-21-7-10(13(22)15(21)24)14(23)20-11-5-6-25-12-4-2-1-3-9(11)12/h1-4,10-11H,5-8H2,(H,20,23) |
| InChIKey | LFDIPJPKAUIXLG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|