C15H28O2 — CID 123942090
(E)-6-methoxy-5,7-dimethyldodec-2-en-4-one (PubChem CID 123942090) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (E)-6-methoxy-5,7-dimethyldodec-2-en-4-one.
| Compound Name | (E)-6-methoxy-5,7-dimethyldodec-2-en-4-one |
|---|---|
| PubChem CID | 123942090 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | (E)-6-methoxy-5,7-dimethyldodec-2-en-4-one |
| SMILES | C/C=C/C(=O)C(C)C(OC)C(C)CCCCC |
| InChI | InChI=1S/C15H28O2/c1-6-8-9-11-12(3)15(17-5)13(4)14(16)10-7-2/h7,10,12-13,15H,6,8-9,11H2,1-5H3/b10-7+ |
| InChIKey | ONSDMEVDUOSDCN-JXMROGBWSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|