About [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol
[4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol (PubChem CID 123942171) has the molecular formula C17H17FN2O4
and a molecular weight of 332.33 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol.
Molecular Properties
| Compound Name | [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol |
| PubChem CID | 123942171 |
| Molecular Formula | C17H17FN2O4 |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol |
| SMILES | CC1(C)CN(c2ccc(F)cc2)c2c(CO)cc([N+](=O)[O-])cc2O1 |
| InChI | InChI=1S/C17H17FN2O4/c1-17(2)10-19(13-5-3-12(18)4-6-13)16-11(9-21)7-14(20(22)23)8-15(16)24-17/h3-8,21H,9-10H2,1-2H3 |
| InChIKey | STERTHPFJIFWNQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol?
The IUPAC name of [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol (CID 123942171) is [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol.
What is the SMILES notation for [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol?
The canonical SMILES for [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol is CC1(C)CN(c2ccc(F)cc2)c2c(CO)cc([N+](=O)[O-])cc2O1.
What is the InChIKey of [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol?
The InChIKey is STERTHPFJIFWNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17FN2O4/c1-17(2)10-19(13-5-3-12(18)4-6-13)16-11(9-21)7-14(20(22)23)8-15(16)24-17/h3-8,21H,9-10H2,1-2H3.
What are the key properties of [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol?
[4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol has a molecular weight of 332.33 g/mol, XLogP of 3.54, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-fluorophenyl)-2,2-dimethyl-7-nitro-3H-1,4-benzoxazin-5-yl]methanol is sourced from PubChem (CID 123942171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).