About 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine
1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine (PubChem CID 123942418) has the molecular formula C20H22N2O3
and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine.
Molecular Properties
| Compound Name | 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine |
| PubChem CID | 123942418 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\[H])c1ccc(Oc2ccc(OC3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c21-12-9-20(22)15-1-3-16(4-2-15)24-17-5-7-18(8-6-17)25-19-10-13-23-14-11-19/h1-8,12,19,21-22H,9-11,13-14H2/b21-12+,22-20+ |
| InChIKey | SYNSAUFLRLCQBT-YPDAGFIYSA-N |
| XLogP | 4.44 |
| TPSA | 75.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine?
The IUPAC name of 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine (CID 123942418) is 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine.
What is the SMILES notation for 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine?
The canonical SMILES for 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine is [H]/N=C/C/C(=N\[H])c1ccc(Oc2ccc(OC3CCOCC3)cc2)cc1.
What is the InChIKey of 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine?
The InChIKey is SYNSAUFLRLCQBT-YPDAGFIYSA-N. The full InChI is InChI=1S/C20H22N2O3/c21-12-9-20(22)15-1-3-16(4-2-15)24-17-5-7-18(8-6-17)25-19-10-13-23-14-11-19/h1-8,12,19,21-22H,9-11,13-14H2/b21-12+,22-20+.
What are the key properties of 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine?
1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine has a molecular weight of 338.41 g/mol, XLogP of 4.44, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(oxan-4-yloxy)phenoxy]phenyl]propane-1,3-diimine is sourced from PubChem (CID 123942418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).