C13H18ClN3O — CID 123943079
5-chloro-2-(5-methyl-1,4-diazepan-1-yl)-5,6-dihydro-1,3-benzoxazole (PubChem CID 123943079) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is 5-chloro-2-(5-methyl-1,4-diazepan-1-yl)-5,6-dihydro-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(5-methyl-1,4-diazepan-1-yl)-5,6-dihydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 123943079 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-chloro-2-(5-methyl-1,4-diazepan-1-yl)-5,6-dihydro-1,3-benzoxazole |
| SMILES | CC1CCN(c2nc3c(o2)=CCC(Cl)C=3)CCN1 |
| InChI | InChI=1S/C13H18ClN3O/c1-9-4-6-17(7-5-15-9)13-16-11-8-10(14)2-3-12(11)18-13/h3,8-10,15H,2,4-7H2,1H3 |
| InChIKey | RLVGBZYRKJOLLX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|