C27H25FN2O6S — CID 123943158
N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-hydroxyethyl]-3-methoxy-4-(2-methoxyethoxy)benzamide (PubChem CID 123943158) has the molecular formula C27H25FN2O6S and a molecular weight of 524.57 g/mol. Its IUPAC name is N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-hydroxyethyl]-3-methoxy-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-hydroxyethyl]-3-methoxy-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 123943158 |
| Molecular Formula | C27H25FN2O6S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | N-[2-(13-fluoro-8-oxa-11-thia-3-azatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,12(17),13,15-heptaen-4-yl)-2-hydroxyethyl]-3-methoxy-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)NCC(O)c2ccc3c(n2)-c2c(sc4c(F)cccc24)CO3)cc1OC |
| InChI | InChI=1S/C27H25FN2O6S/c1-33-10-11-35-20-8-6-15(12-22(20)34-2)27(32)29-13-19(31)18-7-9-21-25(30-18)24-16-4-3-5-17(28)26(16)37-23(24)14-36-21/h3-9,12,19,31H,10-11,13-14H2,1-2H3,(H,29,32) |
| InChIKey | PZVUIGDUXBXZGK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 99.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|