About 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one
4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one (PubChem CID 123943535) has the molecular formula C8H9F3O
and a molecular weight of 178.15 g/mol. Its IUPAC name is 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one.
Molecular Properties
| Compound Name | 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one |
| PubChem CID | 123943535 |
| Molecular Formula | C8H9F3O |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one |
| SMILES | CC(=O)C=C(C1CC1)C(F)(F)F |
| InChI | InChI=1S/C8H9F3O/c1-5(12)4-7(6-2-3-6)8(9,10)11/h4,6H,2-3H2,1H3 |
| InChIKey | ABGPZWFHZCGULR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one?
The IUPAC name of 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one (CID 123943535) is 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one.
What is the SMILES notation for 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one?
The canonical SMILES for 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one is CC(=O)C=C(C1CC1)C(F)(F)F.
What is the InChIKey of 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one?
The InChIKey is ABGPZWFHZCGULR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F3O/c1-5(12)4-7(6-2-3-6)8(9,10)11/h4,6H,2-3H2,1H3.
What are the key properties of 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one?
4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one has a molecular weight of 178.15 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5,5,5-trifluoropent-3-en-2-one is sourced from PubChem (CID 123943535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).