About 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine
8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine (PubChem CID 123943619) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine |
| PubChem CID | 123943619 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine |
| SMILES | CCN1C=CCC2=C(C)NC=NC21 |
| InChI | InChI=1S/C10H15N3/c1-3-13-6-4-5-9-8(2)11-7-12-10(9)13/h4,6-7,10H,3,5H2,1-2H3,(H,11,12) |
| InChIKey | NXWBPRLBLPFDGG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine?
The IUPAC name of 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine (CID 123943619) is 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine.
What is the SMILES notation for 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine?
The canonical SMILES for 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine is CCN1C=CCC2=C(C)NC=NC21.
What is the InChIKey of 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine?
The InChIKey is NXWBPRLBLPFDGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-3-13-6-4-5-9-8(2)11-7-12-10(9)13/h4,6-7,10H,3,5H2,1-2H3,(H,11,12).
What are the key properties of 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine?
8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine has a molecular weight of 177.25 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-4-methyl-5,8a-dihydro-3H-pyrido[2,3-d]pyrimidine is sourced from PubChem (CID 123943619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).