C25H40O5 — CID 123943656
(4E)-13-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-3,7,11-trimethyltrideca-4,7,11-trien-2-one (PubChem CID 123943656) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is (4E)-13-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-3,7,11-trimethyltrideca-4,7,11-trien-2-one.
| Compound Name | (4E)-13-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-3,7,11-trimethyltrideca-4,7,11-trien-2-one |
|---|---|
| PubChem CID | 123943656 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | (4E)-13-(2,5-dihydroxy-3,4-dimethoxy-6-methylcyclohex-3-en-1-yl)-3,7,11-trimethyltrideca-4,7,11-trien-2-one |
| SMILES | COC1=C(OC)C(O)C(CC=C(C)CCC=C(C)C/C=C/C(C)C(C)=O)C(C)C1O |
| InChI | InChI=1S/C25H40O5/c1-16(12-9-13-18(3)20(5)26)10-8-11-17(2)14-15-21-19(4)22(27)24(29-6)25(30-7)23(21)28/h9-10,13-14,18-19,21-23,27-28H,8,11-12,15H2,1-7H3/b13-9+,16-10?,17-14? |
| InChIKey | IXPLSXKYEJWROZ-VJQGEPTOSA-N |
| XLogP | 4.71 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|