C29H40O9 — CID 123943744
(1R,8R,12R,24R,25S)-12-hydroxy-17-(methoxymethyl)-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione (PubChem CID 123943744) has the molecular formula C29H40O9 and a molecular weight of 532.63 g/mol. Its IUPAC name is (1R,8R,12R,24R,25S)-12-hydroxy-17-(methoxymethyl)-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione.
| Compound Name | (1R,8R,12R,24R,25S)-12-hydroxy-17-(methoxymethyl)-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione |
|---|---|
| PubChem CID | 123943744 |
| Molecular Formula | C29H40O9 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.27 |
| IUPAC Name | (1R,8R,12R,24R,25S)-12-hydroxy-17-(methoxymethyl)-5,13,25-trimethylspiro[2,10,16,23-tetraoxatetracyclo[22.2.1.03,8.08,25]heptacosa-4,18,20-triene-26,2'-oxirane]-11,22-dione |
| SMILES | COCC1C=CC=CC(=O)O[C@@H]2C[C@H]3OC4C=C(C)CC[C@]4(COC(=O)[C@H](O)C(C)CCO1)[C@]2(C)C31CO1 |
| InChI | InChI=1S/C29H40O9/c1-18-9-11-28-16-35-26(32)25(31)19(2)10-12-34-20(15-33-4)7-5-6-8-24(30)38-21-14-23(37-22(28)13-18)29(17-36-29)27(21,28)3/h5-8,13,19-23,25,31H,9-12,14-17H2,1-4H3/t19?,20?,21-,22?,23-,25-,27-,28-,29?/m1/s1 |
| InChIKey | PTDYWYGGKFUBSW-JHMGXAHFSA-N |
| XLogP | 2.66 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|