C24H33F3N4O2 — CID 123944231
3-[4-[3-[5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-2-methylbutyl]-5-ethylpyrazol-1-yl]propanamide (PubChem CID 123944231) has the molecular formula C24H33F3N4O2 and a molecular weight of 466.55 g/mol. Its IUPAC name is 3-[4-[3-[5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-2-methylbutyl]-5-ethylpyrazol-1-yl]propanamide.
| Compound Name | 3-[4-[3-[5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-2-methylbutyl]-5-ethylpyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 123944231 |
| Molecular Formula | C24H33F3N4O2 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 3-[4-[3-[5-amino-6-(2,4,5-trifluorophenyl)oxan-3-yl]-2-methylbutyl]-5-ethylpyrazol-1-yl]propanamide |
| SMILES | CCc1c(CC(C)C(C)C2COC(c3cc(F)c(F)cc3F)C(N)C2)cnn1CCC(N)=O |
| InChI | InChI=1S/C24H33F3N4O2/c1-4-22-15(11-30-31(22)6-5-23(29)32)7-13(2)14(3)16-8-21(28)24(33-12-16)17-9-19(26)20(27)10-18(17)25/h9-11,13-14,16,21,24H,4-8,12,28H2,1-3H3,(H2,29,32) |
| InChIKey | GSULKYXBFGKHTQ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|