C9H13NOSi — CID 123944874
2,2-dimethyl-3,4-dihydro-1,4,2-benzoxazasiline (PubChem CID 123944874) has the molecular formula C9H13NOSi and a molecular weight of 179.30 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydro-1,4,2-benzoxazasiline.
| Compound Name | 2,2-dimethyl-3,4-dihydro-1,4,2-benzoxazasiline |
|---|---|
| PubChem CID | 123944874 |
| Molecular Formula | C9H13NOSi |
| Molecular Weight | 179.30 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydro-1,4,2-benzoxazasiline |
| SMILES | C[Si]1(C)CNc2ccccc2O1 |
| InChI | InChI=1S/C9H13NOSi/c1-12(2)7-10-8-5-3-4-6-9(8)11-12/h3-6,10H,7H2,1-2H3 |
| InChIKey | GKMCMGKDGHHTSW-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|