C17H26N2 — CID 123944889
3,3,4,7,8-pentamethyl-4,4a,5,6,7,8-hexahydro-2H-1,10-phenanthroline (PubChem CID 123944889) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 3,3,4,7,8-pentamethyl-4,4a,5,6,7,8-hexahydro-2H-1,10-phenanthroline.
| Compound Name | 3,3,4,7,8-pentamethyl-4,4a,5,6,7,8-hexahydro-2H-1,10-phenanthroline |
|---|---|
| PubChem CID | 123944889 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3,3,4,7,8-pentamethyl-4,4a,5,6,7,8-hexahydro-2H-1,10-phenanthroline |
| SMILES | CC1C=NC2=C(CCC3C2=NCC(C)(C)C3C)C1C |
| InChI | InChI=1S/C17H26N2/c1-10-8-18-15-13(11(10)2)6-7-14-12(3)17(4,5)9-19-16(14)15/h8,10-12,14H,6-7,9H2,1-5H3 |
| InChIKey | OQXXRHVDFNOLIM-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |