About 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide
7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide (PubChem CID 123944981) has the molecular formula C12H18N2O
and a molecular weight of 206.29 g/mol. Its IUPAC name is 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide |
| PubChem CID | 123944981 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide |
| SMILES | [H]/N=C1\C=CC(C)(CCC)CC=C1C(N)=O |
| InChI | InChI=1S/C12H18N2O/c1-3-6-12(2)7-4-9(11(14)15)10(13)5-8-12/h4-5,8,13H,3,6-7H2,1-2H3,(H2,14,15)/b13-10+ |
| InChIKey | QHLZTDAPBRDAAJ-JLHYYAGUSA-N |
| XLogP | 2.18 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide?
The IUPAC name of 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide (CID 123944981) is 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide.
What is the SMILES notation for 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide?
The canonical SMILES for 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide is [H]/N=C1\C=CC(C)(CCC)CC=C1C(N)=O.
What is the InChIKey of 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide?
The InChIKey is QHLZTDAPBRDAAJ-JLHYYAGUSA-N. The full InChI is InChI=1S/C12H18N2O/c1-3-6-12(2)7-4-9(11(14)15)10(13)5-8-12/h4-5,8,13H,3,6-7H2,1-2H3,(H2,14,15)/b13-10+.
What are the key properties of 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide?
7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide has a molecular weight of 206.29 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-imino-4-methyl-4-propylcyclohepta-1,5-diene-1-carboxamide is sourced from PubChem (CID 123944981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).