About [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid
[(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid (PubChem CID 123945529) has the molecular formula C19H21FN2O2
and a molecular weight of 328.39 g/mol. Its IUPAC name is [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid |
| PubChem CID | 123945529 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)[C@]1(Cc2ccccc2)CNC[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H21FN2O2/c1-22(18(23)24)19(11-14-5-3-2-4-6-14)13-21-12-17(19)15-7-9-16(20)10-8-15/h2-10,17,21H,11-13H2,1H3,(H,23,24)/t17-,19+/m0/s1 |
| InChIKey | KQVIASCHUMBNCH-PKOBYXMFSA-N |
| XLogP | 3.10 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid?
The IUPAC name of [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid (CID 123945529) is [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid.
What is the SMILES notation for [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid?
The canonical SMILES for [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid is CN(C(=O)O)[C@]1(Cc2ccccc2)CNC[C@H]1c1ccc(F)cc1.
What is the InChIKey of [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid?
The InChIKey is KQVIASCHUMBNCH-PKOBYXMFSA-N. The full InChI is InChI=1S/C19H21FN2O2/c1-22(18(23)24)19(11-14-5-3-2-4-6-14)13-21-12-17(19)15-7-9-16(20)10-8-15/h2-10,17,21H,11-13H2,1H3,(H,23,24)/t17-,19+/m0/s1.
What are the key properties of [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid?
[(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid has a molecular weight of 328.39 g/mol, XLogP of 3.10, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-3-benzyl-4-(4-fluorophenyl)pyrrolidin-3-yl]-methylcarbamic acid is sourced from PubChem (CID 123945529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).