C30H40F3N5O3S — CID 123945547
2-amino-5-[4-[4-(4,4-dimethylcyclohexen-1-yl)imino-2-ethylbutyl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (PubChem CID 123945547) has the molecular formula C30H40F3N5O3S and a molecular weight of 607.74 g/mol. Its IUPAC name is 2-amino-5-[4-[4-(4,4-dimethylcyclohexen-1-yl)imino-2-ethylbutyl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-[4-[4-(4,4-dimethylcyclohexen-1-yl)imino-2-ethylbutyl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 123945547 |
| Molecular Formula | C30H40F3N5O3S |
| Molecular Weight | 607.74 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 2-amino-5-[4-[4-(4,4-dimethylcyclohexen-1-yl)imino-2-ethylbutyl]-3,5-dihydro-2H-1,4-benzoxazepin-7-yl]-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| SMILES | CCC(C/C=N/C1=CCC(C)(C)CC1)CN1CCOc2ccc(-c3cnc(N)c(S(=O)(=O)NCC(F)(F)F)c3)cc2C1 |
| InChI | InChI=1S/C30H40F3N5O3S/c1-4-21(9-12-35-25-7-10-29(2,3)11-8-25)18-38-13-14-41-26-6-5-22(15-24(26)19-38)23-16-27(28(34)36-17-23)42(39,40)37-20-30(31,32)33/h5-7,12,15-17,21,37H,4,8-11,13-14,18-20H2,1-3H3,(H2,34,36)/b35-12+ |
| InChIKey | XQXVFKUINLFXBO-RHQFVSDJSA-N |
| XLogP | 5.95 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.74 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|