C9H11F2NO — CID 123945729
N-(3,5-difluorohepta-1,3,5-trien-4-yl)acetamide (PubChem CID 123945729) has the molecular formula C9H11F2NO and a molecular weight of 187.19 g/mol. Its IUPAC name is N-(3,5-difluorohepta-1,3,5-trien-4-yl)acetamide.
| Compound Name | N-(3,5-difluorohepta-1,3,5-trien-4-yl)acetamide |
|---|---|
| PubChem CID | 123945729 |
| Molecular Formula | C9H11F2NO |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | N-(3,5-difluorohepta-1,3,5-trien-4-yl)acetamide |
| SMILES | C=CC(F)=C(NC(C)=O)C(F)=CC |
| InChI | InChI=1S/C9H11F2NO/c1-4-7(10)9(8(11)5-2)12-6(3)13/h4-5H,1H2,2-3H3,(H,12,13) |
| InChIKey | SIMIQZLGEOVDAD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|