C27H31N5O3S — CID 123945753
9-[[[4-[4-(dimethylamino)but-2-enoyl]-2,3-dihydro-1,4-benzoxazin-6-yl]amino]methyl]-3-methyl-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one (PubChem CID 123945753) has the molecular formula C27H31N5O3S and a molecular weight of 505.64 g/mol. Its IUPAC name is 9-[[[4-[4-(dimethylamino)but-2-enoyl]-2,3-dihydro-1,4-benzoxazin-6-yl]amino]methyl]-3-methyl-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one.
| Compound Name | 9-[[[4-[4-(dimethylamino)but-2-enoyl]-2,3-dihydro-1,4-benzoxazin-6-yl]amino]methyl]-3-methyl-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 123945753 |
| Molecular Formula | C27H31N5O3S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.21 |
| IUPAC Name | 9-[[[4-[4-(dimethylamino)but-2-enoyl]-2,3-dihydro-1,4-benzoxazin-6-yl]amino]methyl]-3-methyl-1,2,3,4-tetrahydro-[1]benzothiolo[3,2-e][1,4]diazepin-5-one |
| SMILES | CC1CNc2c(sc3ccc(CNc4ccc5c(c4)N(C(=O)C=CCN(C)C)CCO5)cc23)C(=O)N1 |
| InChI | InChI=1S/C27H31N5O3S/c1-17-15-29-25-20-13-18(6-9-23(20)36-26(25)27(34)30-17)16-28-19-7-8-22-21(14-19)32(11-12-35-22)24(33)5-4-10-31(2)3/h4-9,13-14,17,28-29H,10-12,15-16H2,1-3H3,(H,30,34) |
| InChIKey | FAWQLVJMVZZUGB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|