About 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine
4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine (PubChem CID 123945882) has the molecular formula C9H8Cl2N2S
and a molecular weight of 247.15 g/mol. Its IUPAC name is 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine.
Molecular Properties
| Compound Name | 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine |
| PubChem CID | 123945882 |
| Molecular Formula | C9H8Cl2N2S |
| Molecular Weight | 247.15 g/mol |
| Exact Mass | 245.98 |
| IUPAC Name | 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine |
| SMILES | CCC1C=C(Cl)N=C(Cl)c2ncsc21 |
| InChI | InChI=1S/C9H8Cl2N2S/c1-2-5-3-6(10)13-9(11)7-8(5)14-4-12-7/h3-5H,2H2,1H3 |
| InChIKey | MJSHMTWZNSTNRK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.15 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine?
The IUPAC name of 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine (CID 123945882) is 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine.
What is the SMILES notation for 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine?
The canonical SMILES for 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine is CCC1C=C(Cl)N=C(Cl)c2ncsc21.
What is the InChIKey of 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine?
The InChIKey is MJSHMTWZNSTNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2N2S/c1-2-5-3-6(10)13-9(11)7-8(5)14-4-12-7/h3-5H,2H2,1H3.
What are the key properties of 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine?
4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine has a molecular weight of 247.15 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichloro-8-ethyl-8H-[1,3]thiazolo[4,5-c]azepine is sourced from PubChem (CID 123945882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).