C19H14N2O3 — CID 123945958
3-cyclohepta-1,3,4,6-tetraen-1-yl-2-[(4-phenyl-1,3-oxazol-2-yl)imino]propanoic acid (PubChem CID 123945958) has the molecular formula C19H14N2O3 and a molecular weight of 318.33 g/mol. Its IUPAC name is 3-cyclohepta-1,3,4,6-tetraen-1-yl-2-[(4-phenyl-1,3-oxazol-2-yl)imino]propanoic acid.
| Compound Name | 3-cyclohepta-1,3,4,6-tetraen-1-yl-2-[(4-phenyl-1,3-oxazol-2-yl)imino]propanoic acid |
|---|---|
| PubChem CID | 123945958 |
| Molecular Formula | C19H14N2O3 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 3-cyclohepta-1,3,4,6-tetraen-1-yl-2-[(4-phenyl-1,3-oxazol-2-yl)imino]propanoic acid |
| SMILES | O=C(O)C(CC1=CC=C=CC=C1)=Nc1nc(-c2ccccc2)co1 |
| InChI | InChI=1S/C19H14N2O3/c22-18(23)16(12-14-8-4-1-2-5-9-14)20-19-21-17(13-24-19)15-10-6-3-7-11-15/h1,3-11,13H,12H2,(H,22,23) |
| InChIKey | IKZSKIWHTZHQJG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|