About (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate
(6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate (PubChem CID 123946106) has the molecular formula C21H36O2
and a molecular weight of 320.52 g/mol. Its IUPAC name is (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate.
Molecular Properties
| Compound Name | (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate |
| PubChem CID | 123946106 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate |
| SMILES | CC(C)CC(C(=O)OC1(C)C(C)CC23CC2CC1C3)C(C)(C)C |
| InChI | InChI=1S/C21H36O2/c1-13(2)8-17(19(4,5)6)18(22)23-20(7)14(3)10-21-11-15(20)9-16(21)12-21/h13-17H,8-12H2,1-7H3 |
| InChIKey | NXFIARCLTTYMFS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate?
The IUPAC name of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate (CID 123946106) is (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate.
What is the SMILES notation for (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate?
The canonical SMILES for (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate is CC(C)CC(C(=O)OC1(C)C(C)CC23CC2CC1C3)C(C)(C)C.
What is the InChIKey of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate?
The InChIKey is NXFIARCLTTYMFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36O2/c1-13(2)8-17(19(4,5)6)18(22)23-20(7)14(3)10-21-11-15(20)9-16(21)12-21/h13-17H,8-12H2,1-7H3.
What are the key properties of (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate?
(6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate has a molecular weight of 320.52 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6,7-dimethyl-6-tricyclo[3.3.1.01,3]nonanyl) 2-tert-butyl-4-methylpentanoate is sourced from PubChem (CID 123946106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).