C13H16F2N2S — CID 123946336
5-[1-(4,4-difluoropiperidin-1-yl)pent-2-ynyl]-1,3-thiazole (PubChem CID 123946336) has the molecular formula C13H16F2N2S and a molecular weight of 270.35 g/mol. Its IUPAC name is 5-[1-(4,4-difluoropiperidin-1-yl)pent-2-ynyl]-1,3-thiazole.
| Compound Name | 5-[1-(4,4-difluoropiperidin-1-yl)pent-2-ynyl]-1,3-thiazole |
|---|---|
| PubChem CID | 123946336 |
| Molecular Formula | C13H16F2N2S |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 5-[1-(4,4-difluoropiperidin-1-yl)pent-2-ynyl]-1,3-thiazole |
| SMILES | CCC#CC(c1cncs1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H16F2N2S/c1-2-3-4-11(12-9-16-10-18-12)17-7-5-13(14,15)6-8-17/h9-11H,2,5-8H2,1H3 |
| InChIKey | BCTBVFZFJCKKIV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|